2,6-dimethyl-3-isopropylheptane
CAS:<62185-45-9>
Formula:C12H26; 170.34 g/mol
InChiKey:NOAGKIODSFDOTA-UHFFFAOYSA-N
SMILES:CC(C)CCC(C(C)C)C(C)C
*
Density:0.765 g/mL
Molar volume:222.5 mL/mol
Refractive index:1.432
Molecular refractive power:57.72 mL/mol
Boiling point:187 °C

Isomers

3,3-diethyloctane
*
3,6-diethyloctane
*
2,5-dimethyldecane
*
2,6-dimethyldecane
*
2,7-dimethyldecane
*
2,9-dimethyldecane
*
3,3-dimethyldecane
*
3,6-dimethyldecane
*
2,6-dimethyl-3-isopropylheptane
*
dodecane
*
3-ethyldecane
*
5-ethyldecane
*
4-ethyl-4-propylheptane
*
2-methyl-5-propyloctane
*
2-methylundecane
*
3-methylundecane
*
5-methylundecane
*
2,2,4,6,6-pentamethylheptane
*
5-propylnonane
*
2,2,4,7-tetramethyloctane
*
2,2,6,6-tetramethyloctane
*
2,2,7,7-tetramethyloctane
*
2,3,6,7-tetramethyloctane
*
2,4,4,7-tetramethyloctane
*
2,4,5,7-tetramethyloctane
*
3,3,6,6-tetramethyloctane
*
2,5,8-trimethylnonane
*